C15H23N3O3S — CID 43039868
N-[2-[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]ethyl]-2-methylpropanamide (PubChem CID 43039868) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is N-[2-[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 43039868 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-[2-[(3-acetamido-3-thiophen-2-ylpropanoyl)amino]ethyl]-2-methylpropanamide |
| SMILES | CC(=O)NC(CC(=O)NCCNC(=O)C(C)C)c1cccs1 |
| InChI | InChI=1S/C15H23N3O3S/c1-10(2)15(21)17-7-6-16-14(20)9-12(18-11(3)19)13-5-4-8-22-13/h4-5,8,10,12H,6-7,9H2,1-3H3,(H,16,20)(H,17,21)(H,18,19) |
| InChIKey | HFSIXXBNRVUSFP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|