C22H22N2O4S — CID 43039911
3-(phenoxymethyl)-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)furan-2-carbohydrazide (PubChem CID 43039911) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is 3-(phenoxymethyl)-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)furan-2-carbohydrazide.
| Compound Name | 3-(phenoxymethyl)-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 43039911 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 3-(phenoxymethyl)-N'-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonyl)furan-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1occc1COc1ccccc1)c1cc2c(s1)CCCCC2 |
| InChI | InChI=1S/C22H22N2O4S/c25-21(19-13-15-7-3-1-6-10-18(15)29-19)23-24-22(26)20-16(11-12-27-20)14-28-17-8-4-2-5-9-17/h2,4-5,8-9,11-13H,1,3,6-7,10,14H2,(H,23,25)(H,24,26) |
| InChIKey | OYVJIDIHRXDNOG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|