C20H15ClN4OS — CID 43040259
2-[1-(4-chlorophenyl)imidazol-2-yl]sulfanyl-N-quinolin-5-ylacetamide (PubChem CID 43040259) has the molecular formula C20H15ClN4OS and a molecular weight of 394.89 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)imidazol-2-yl]sulfanyl-N-quinolin-5-ylacetamide.
| Compound Name | 2-[1-(4-chlorophenyl)imidazol-2-yl]sulfanyl-N-quinolin-5-ylacetamide |
|---|---|
| PubChem CID | 43040259 |
| Molecular Formula | C20H15ClN4OS |
| Molecular Weight | 394.89 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-[1-(4-chlorophenyl)imidazol-2-yl]sulfanyl-N-quinolin-5-ylacetamide |
| SMILES | O=C(CSc1nccn1-c1ccc(Cl)cc1)Nc1cccc2ncccc12 |
| InChI | InChI=1S/C20H15ClN4OS/c21-14-6-8-15(9-7-14)25-12-11-23-20(25)27-13-19(26)24-18-5-1-4-17-16(18)3-2-10-22-17/h1-12H,13H2,(H,24,26) |
| InChIKey | JPBONAUYCLYWFI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.89 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |