C23H27ClN4O3S — CID 43040722
N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 43040722) has the molecular formula C23H27ClN4O3S and a molecular weight of 475.01 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 43040722 |
| Molecular Formula | C23H27ClN4O3S |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CC(=O)Nc1ncc(Cc3cccc(Cl)c3)s1)C2=O |
| InChI | InChI=1S/C23H27ClN4O3S/c1-14-9-22(2,3)13-23(10-14)19(30)28(21(31)27-23)12-18(29)26-20-25-11-17(32-20)8-15-5-4-6-16(24)7-15/h4-7,11,14H,8-10,12-13H2,1-3H3,(H,27,31)(H,25,26,29) |
| InChIKey | IBJSDZSXAZXKEV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|