C21H24N2O3S2 — CID 43042979
[5-(5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 2-thiophen-2-ylacetate (PubChem CID 43042979) has the molecular formula C21H24N2O3S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is [5-(5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 2-thiophen-2-ylacetate.
| Compound Name | [5-(5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 43042979 |
| Molecular Formula | C21H24N2O3S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [5-(5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 2-thiophen-2-ylacetate |
| SMILES | CC(C)(C)C1CCc2sc(-c3nnc(COC(=O)Cc4cccs4)o3)cc2C1 |
| InChI | InChI=1S/C21H24N2O3S2/c1-21(2,3)14-6-7-16-13(9-14)10-17(28-16)20-23-22-18(26-20)12-25-19(24)11-15-5-4-8-27-15/h4-5,8,10,14H,6-7,9,11-12H2,1-3H3 |
| InChIKey | POTBXEJRCIHNAU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |