C29H33ClN2O5S — CID 4304336
[1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-1-oxopropan-2-yl] 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 4304336) has the molecular formula C29H33ClN2O5S and a molecular weight of 557.11 g/mol. Its IUPAC name is [1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-1-oxopropan-2-yl] 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | [1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-1-oxopropan-2-yl] 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 4304336 |
| Molecular Formula | C29H33ClN2O5S |
| Molecular Weight | 557.11 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | [1-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-1-oxopropan-2-yl] 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | Cc1cc(C(=O)C(C)OC(=O)c2ccc(S(=O)(=O)N3CC(C)CC(C)C3)cc2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H33ClN2O5S/c1-18-14-19(2)17-31(16-18)38(35,36)26-12-6-23(7-13-26)29(34)37-22(5)28(33)27-15-20(3)32(21(27)4)25-10-8-24(30)9-11-25/h6-13,15,18-19,22H,14,16-17H2,1-5H3 |
| InChIKey | LAKRZBYTJRWVGK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.11 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|