C29H33N3O2 — CID 4304340
N-(1-adamantylmethyl)-3-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]propanamide (PubChem CID 4304340) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-3-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]propanamide.
| Compound Name | N-(1-adamantylmethyl)-3-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]propanamide |
|---|---|
| PubChem CID | 4304340 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | N-(1-adamantylmethyl)-3-[3-(4-methylphenyl)-4-oxoquinazolin-2-yl]propanamide |
| SMILES | Cc1ccc(-n2c(CCC(=O)NCC34CC5CC(CC(C5)C3)C4)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C29H33N3O2/c1-19-6-8-23(9-7-19)32-26(31-25-5-3-2-4-24(25)28(32)34)10-11-27(33)30-18-29-15-20-12-21(16-29)14-22(13-20)17-29/h2-9,20-22H,10-18H2,1H3,(H,30,33) |
| InChIKey | ZLCKGZQIMLGCHH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |