About ethyl N-[(2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl)amino]carbamate
ethyl N-[(2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl)amino]carbamate (PubChem CID 43044207) has the molecular formula C14H18N4O3S
and a molecular weight of 322.39 g/mol. Its IUPAC name is ethyl N-[(2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl)amino]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl)amino]carbamate |
| PubChem CID | 43044207 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | ethyl N-[(2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl)amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)c1sc2nc(CC)nc(C)c2c1C |
| InChI | InChI=1S/C14H18N4O3S/c1-5-9-15-8(4)10-7(3)11(22-13(10)16-9)12(19)17-18-14(20)21-6-2/h5-6H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | FUKAOFVOKOAGNP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl)amino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl)amino]carbamate?
The IUPAC name of ethyl N-[(2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl)amino]carbamate (CID 43044207) is ethyl N-[(2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl)amino]carbamate.
What is the SMILES notation for ethyl N-[(2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl)amino]carbamate?
The canonical SMILES for ethyl N-[(2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl)amino]carbamate is CCOC(=O)NNC(=O)c1sc2nc(CC)nc(C)c2c1C.
What is the InChIKey of ethyl N-[(2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl)amino]carbamate?
The InChIKey is FUKAOFVOKOAGNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O3S/c1-5-9-15-8(4)10-7(3)11(22-13(10)16-9)12(19)17-18-14(20)21-6-2/h5-6H2,1-4H3,(H,17,19)(H,18,20).
What are the key properties of ethyl N-[(2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl)amino]carbamate?
ethyl N-[(2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl)amino]carbamate has a molecular weight of 322.39 g/mol, XLogP of 2.26, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbonyl)amino]carbamate is sourced from PubChem (CID 43044207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).