About N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-(trifluoromethyl)pyridine-3-carboxamide
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 43044268) has the molecular formula C15H17F3N4O
and a molecular weight of 326.32 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| PubChem CID | 43044268 |
| Molecular Formula | C15H17F3N4O |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)c2ccc(C(F)(F)F)nc2)n1 |
| InChI | InChI=1S/C15H17F3N4O/c1-10-8-11(2)22(21-10)7-3-6-19-14(23)12-4-5-13(20-9-12)15(16,17)18/h4-5,8-9H,3,6-7H2,1-2H3,(H,19,23) |
| InChIKey | NUWODXGSEPGPQY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-(trifluoromethyl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-(trifluoromethyl)pyridine-3-carboxamide?
The IUPAC name of N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-(trifluoromethyl)pyridine-3-carboxamide (CID 43044268) is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
What is the SMILES notation for N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-(trifluoromethyl)pyridine-3-carboxamide?
The canonical SMILES for N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-(trifluoromethyl)pyridine-3-carboxamide is Cc1cc(C)n(CCCNC(=O)c2ccc(C(F)(F)F)nc2)n1.
What is the InChIKey of N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-(trifluoromethyl)pyridine-3-carboxamide?
The InChIKey is NUWODXGSEPGPQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F3N4O/c1-10-8-11(2)22(21-10)7-3-6-19-14(23)12-4-5-13(20-9-12)15(16,17)18/h4-5,8-9H,3,6-7H2,1-2H3,(H,19,23).
What are the key properties of N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-(trifluoromethyl)pyridine-3-carboxamide?
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-(trifluoromethyl)pyridine-3-carboxamide has a molecular weight of 326.32 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-6-(trifluoromethyl)pyridine-3-carboxamide is sourced from PubChem (CID 43044268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).