C30H23F5NO+ — CID 4304486
dimethyl-[4-[[2-(2,3,4,5,6-pentafluorophenyl)-4-phenyl-6,7-dihydro-5H-chromen-8-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]azanium (PubChem CID 4304486) has the molecular formula C30H23F5NO+ and a molecular weight of 508.51 g/mol. Its IUPAC name is dimethyl-[4-[[2-(2,3,4,5,6-pentafluorophenyl)-4-phenyl-6,7-dihydro-5H-chromen-8-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]azanium.
| Compound Name | dimethyl-[4-[[2-(2,3,4,5,6-pentafluorophenyl)-4-phenyl-6,7-dihydro-5H-chromen-8-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 4304486 |
| Molecular Formula | C30H23F5NO+ |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | dimethyl-[4-[[2-(2,3,4,5,6-pentafluorophenyl)-4-phenyl-6,7-dihydro-5H-chromen-8-yl]methylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
| SMILES | C[N+](C)=C1C=CC(=CC2=C3OC(c4c(F)c(F)c(F)c(F)c4F)=CC(c4ccccc4)=C3CCC2)C=C1 |
| InChI | InChI=1S/C30H23F5NO/c1-36(2)20-13-11-17(12-14-20)15-19-9-6-10-21-22(18-7-4-3-5-8-18)16-23(37-30(19)21)24-25(31)27(33)29(35)28(34)26(24)32/h3-5,7-8,11-16H,6,9-10H2,1-2H3/q+1 |
| InChIKey | YGHBVZWFJZPERN-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|