C16H17F3N2O4S — CID 43047806
2-(2-methoxyethoxy)-N-[5-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 43047806) has the molecular formula C16H17F3N2O4S and a molecular weight of 390.38 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-[5-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(2-methoxyethoxy)-N-[5-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 43047806 |
| Molecular Formula | C16H17F3N2O4S |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-[5-[[4-(trifluoromethoxy)phenyl]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | COCCOCC(=O)Nc1ncc(Cc2ccc(OC(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C16H17F3N2O4S/c1-23-6-7-24-10-14(22)21-15-20-9-13(26-15)8-11-2-4-12(5-3-11)25-16(17,18)19/h2-5,9H,6-8,10H2,1H3,(H,20,21,22) |
| InChIKey | CXGFZGSMBZZSAZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|