C22H24N4O3 — CID 43048123
5-methyl-5-(4-methylphenyl)-3-[2-oxo-2-(2-pyridin-4-ylpyrrolidin-1-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 43048123) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 5-methyl-5-(4-methylphenyl)-3-[2-oxo-2-(2-pyridin-4-ylpyrrolidin-1-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5-methyl-5-(4-methylphenyl)-3-[2-oxo-2-(2-pyridin-4-ylpyrrolidin-1-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43048123 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 5-methyl-5-(4-methylphenyl)-3-[2-oxo-2-(2-pyridin-4-ylpyrrolidin-1-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(C2(C)NC(=O)N(CC(=O)N3CCCC3c3ccncc3)C2=O)cc1 |
| InChI | InChI=1S/C22H24N4O3/c1-15-5-7-17(8-6-15)22(2)20(28)26(21(29)24-22)14-19(27)25-13-3-4-18(25)16-9-11-23-12-10-16/h5-12,18H,3-4,13-14H2,1-2H3,(H,24,29) |
| InChIKey | RKUGPGLZNIZARB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|