C19H19F2NO3 — CID 43048492
[1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2,4,6-trimethylbenzoate (PubChem CID 43048492) has the molecular formula C19H19F2NO3 and a molecular weight of 347.36 g/mol. Its IUPAC name is [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2,4,6-trimethylbenzoate.
| Compound Name | [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 43048492 |
| Molecular Formula | C19H19F2NO3 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OC(C)C(=O)Nc2ccc(F)cc2F)c(C)c1 |
| InChI | InChI=1S/C19H19F2NO3/c1-10-7-11(2)17(12(3)8-10)19(24)25-13(4)18(23)22-16-6-5-14(20)9-15(16)21/h5-9,13H,1-4H3,(H,22,23) |
| InChIKey | APEIMTRZEOIMKH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |