About 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylethanamine
1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylethanamine (PubChem CID 43049439) has the molecular formula C21H27N3O2
and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylethanamine.
Molecular Properties
| Compound Name | 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylethanamine |
| PubChem CID | 43049439 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylethanamine |
| SMILES | COc1ccc2cc(CN(C)C(C)c3nc(C(C)(C)C)no3)ccc2c1 |
| InChI | InChI=1S/C21H27N3O2/c1-14(19-22-20(23-26-19)21(2,3)4)24(5)13-15-7-8-17-12-18(25-6)10-9-16(17)11-15/h7-12,14H,13H2,1-6H3 |
| InChIKey | PLPHECHECPEGHY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylethanamine?
The IUPAC name of 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylethanamine (CID 43049439) is 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylethanamine.
What is the SMILES notation for 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylethanamine?
The canonical SMILES for 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylethanamine is COc1ccc2cc(CN(C)C(C)c3nc(C(C)(C)C)no3)ccc2c1.
What is the InChIKey of 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylethanamine?
The InChIKey is PLPHECHECPEGHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3O2/c1-14(19-22-20(23-26-19)21(2,3)4)24(5)13-15-7-8-17-12-18(25-6)10-9-16(17)11-15/h7-12,14H,13H2,1-6H3.
What are the key properties of 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylethanamine?
1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylethanamine has a molecular weight of 353.47 g/mol, XLogP of 4.72, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(6-methoxynaphthalen-2-yl)methyl]-N-methylethanamine is sourced from PubChem (CID 43049439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).