C21H27N3O5S2 — CID 43050505
N-[1-[2-[(4-methoxyphenyl)sulfonylamino]ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 43050505) has the molecular formula C21H27N3O5S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is N-[1-[2-[(4-methoxyphenyl)sulfonylamino]ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | N-[1-[2-[(4-methoxyphenyl)sulfonylamino]ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 43050505 |
| Molecular Formula | C21H27N3O5S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | N-[1-[2-[(4-methoxyphenyl)sulfonylamino]ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNC(=O)C(CCSC)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H27N3O5S2/c1-29-17-8-10-18(11-9-17)31(27,28)23-14-13-22-21(26)19(12-15-30-2)24-20(25)16-6-4-3-5-7-16/h3-11,19,23H,12-15H2,1-2H3,(H,22,26)(H,24,25) |
| InChIKey | FTPZXFAIKANVDI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|