About (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate
(7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate (PubChem CID 43050635) has the molecular formula C20H18ClN3O6S
and a molecular weight of 463.90 g/mol. Its IUPAC name is (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate.
Molecular Properties
| Compound Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate |
| PubChem CID | 43050635 |
| Molecular Formula | C20H18ClN3O6S |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N(C)CC(=O)OCc2cc(=O)n3cc(Cl)ccc3n2)cc1 |
| InChI | InChI=1S/C20H18ClN3O6S/c1-13(25)14-3-6-17(7-4-14)31(28,29)23(2)11-20(27)30-12-16-9-19(26)24-10-15(21)5-8-18(24)22-16/h3-10H,11-12H2,1-2H3 |
| InChIKey | XQLYLHFHBUXUQH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 115.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate?
The IUPAC name of (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate (CID 43050635) is (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate.
What is the SMILES notation for (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate?
The canonical SMILES for (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate is CC(=O)c1ccc(S(=O)(=O)N(C)CC(=O)OCc2cc(=O)n3cc(Cl)ccc3n2)cc1.
What is the InChIKey of (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate?
The InChIKey is XQLYLHFHBUXUQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18ClN3O6S/c1-13(25)14-3-6-17(7-4-14)31(28,29)23(2)11-20(27)30-12-16-9-19(26)24-10-15(21)5-8-18(24)22-16/h3-10H,11-12H2,1-2H3.
What are the key properties of (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate?
(7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate has a molecular weight of 463.90 g/mol, XLogP of 1.91, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-acetylphenyl)sulfonyl-methylamino]acetate is sourced from PubChem (CID 43050635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).