C15H19N5O2S2 — CID 43052842
2-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazole (PubChem CID 43052842) has the molecular formula C15H19N5O2S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 2-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazole.
| Compound Name | 2-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 43052842 |
| Molecular Formula | C15H19N5O2S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 2-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazole |
| SMILES | Cc1nc(C)c(-c2nnc(SC(C)c3nc(C(C)(C)C)no3)o2)s1 |
| InChI | InChI=1S/C15H19N5O2S2/c1-7-10(24-9(3)16-7)12-18-19-14(21-12)23-8(2)11-17-13(20-22-11)15(4,5)6/h8H,1-6H3 |
| InChIKey | CEOZEZOQIPSQJI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |