C15H20F3N3O2 — CID 43052844
N-(1-ethylpiperidin-4-yl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 43052844) has the molecular formula C15H20F3N3O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is N-(1-ethylpiperidin-4-yl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-(1-ethylpiperidin-4-yl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 43052844 |
| Molecular Formula | C15H20F3N3O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-(1-ethylpiperidin-4-yl)-2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | CCN1CCC(NC(=O)Cn2cccc(C(F)(F)F)c2=O)CC1 |
| InChI | InChI=1S/C15H20F3N3O2/c1-2-20-8-5-11(6-9-20)19-13(22)10-21-7-3-4-12(14(21)23)15(16,17)18/h3-4,7,11H,2,5-6,8-10H2,1H3,(H,19,22) |
| InChIKey | IFGLJZXYVRSQCL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |