C20H28N2O7S — CID 43053567
methyl 6-[[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)pyrrolidine-2-carbonyl]amino]hexanoate (PubChem CID 43053567) has the molecular formula C20H28N2O7S and a molecular weight of 440.52 g/mol. Its IUPAC name is methyl 6-[[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)pyrrolidine-2-carbonyl]amino]hexanoate.
| Compound Name | methyl 6-[[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)pyrrolidine-2-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 43053567 |
| Molecular Formula | C20H28N2O7S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | methyl 6-[[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)pyrrolidine-2-carbonyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)C1CCCN1S(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H28N2O7S/c1-27-19(23)7-3-2-4-10-21-20(24)16-6-5-11-22(16)30(25,26)15-8-9-17-18(14-15)29-13-12-28-17/h8-9,14,16H,2-7,10-13H2,1H3,(H,21,24) |
| InChIKey | MXYVVPVYKPMPKY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|