C29H24ClN3O4 — CID 4305421
[2-(5-naphthalen-2-yl-3-phenyl-3,4-dihydropyrazol-2-yl)-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate (PubChem CID 4305421) has the molecular formula C29H24ClN3O4 and a molecular weight of 513.98 g/mol. Its IUPAC name is [2-(5-naphthalen-2-yl-3-phenyl-3,4-dihydropyrazol-2-yl)-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate.
| Compound Name | [2-(5-naphthalen-2-yl-3-phenyl-3,4-dihydropyrazol-2-yl)-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 4305421 |
| Molecular Formula | C29H24ClN3O4 |
| Molecular Weight | 513.98 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | [2-(5-naphthalen-2-yl-3-phenyl-3,4-dihydropyrazol-2-yl)-2-oxoethyl] 4-amino-5-chloro-2-methoxybenzoate |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)OCC(=O)N1N=C(c2ccc3ccccc3c2)CC1c1ccccc1 |
| InChI | InChI=1S/C29H24ClN3O4/c1-36-27-15-24(31)23(30)14-22(27)29(35)37-17-28(34)33-26(19-8-3-2-4-9-19)16-25(32-33)21-12-11-18-7-5-6-10-20(18)13-21/h2-15,26H,16-17,31H2,1H3 |
| InChIKey | XPMQXNRDYBMFKH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.98 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|