C21H24BrN3O2 — CID 43054825
4-[[[2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl]-cyclopropylamino]methyl]benzamide (PubChem CID 43054825) has the molecular formula C21H24BrN3O2 and a molecular weight of 430.35 g/mol. Its IUPAC name is 4-[[[2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl]-cyclopropylamino]methyl]benzamide.
| Compound Name | 4-[[[2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl]-cyclopropylamino]methyl]benzamide |
|---|---|
| PubChem CID | 43054825 |
| Molecular Formula | C21H24BrN3O2 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 4-[[[2-[1-(4-bromophenyl)ethylamino]-2-oxoethyl]-cyclopropylamino]methyl]benzamide |
| SMILES | CC(NC(=O)CN(Cc1ccc(C(N)=O)cc1)C1CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H24BrN3O2/c1-14(16-6-8-18(22)9-7-16)24-20(26)13-25(19-10-11-19)12-15-2-4-17(5-3-15)21(23)27/h2-9,14,19H,10-13H2,1H3,(H2,23,27)(H,24,26) |
| InChIKey | YGDNQHHBKYWFPB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |