C16H11NO5S — CID 43055786
1,3-benzodioxol-5-yl 2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carboxylate (PubChem CID 43055786) has the molecular formula C16H11NO5S and a molecular weight of 329.33 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl 2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 43055786 |
| Molecular Formula | C16H11NO5S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 1,3-benzodioxol-5-yl 2-(furan-2-yl)-5-methyl-1,3-thiazole-4-carboxylate |
| SMILES | Cc1sc(-c2ccco2)nc1C(=O)Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H11NO5S/c1-9-14(17-15(23-9)12-3-2-6-19-12)16(18)22-10-4-5-11-13(7-10)21-8-20-11/h2-7H,8H2,1H3 |
| InChIKey | VXZNFROOIBIGFN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|