C20H18N2O5 — CID 43056538
2-benzoyloxyethyl 6-cyclopropyl-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 43056538) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is 2-benzoyloxyethyl 6-cyclopropyl-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | 2-benzoyloxyethyl 6-cyclopropyl-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 43056538 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-benzoyloxyethyl 6-cyclopropyl-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | Cc1noc2nc(C3CC3)cc(C(=O)OCCOC(=O)c3ccccc3)c12 |
| InChI | InChI=1S/C20H18N2O5/c1-12-17-15(11-16(13-7-8-13)21-18(17)27-22-12)20(24)26-10-9-25-19(23)14-5-3-2-4-6-14/h2-6,11,13H,7-10H2,1H3 |
| InChIKey | DJSYEPBSWBMTTC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|