C18H24N4O3S — CID 43057825
N-[3-(oxolan-2-ylmethoxy)phenyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 43057825) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[3-(oxolan-2-ylmethoxy)phenyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-[3-(oxolan-2-ylmethoxy)phenyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 43057825 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[3-(oxolan-2-ylmethoxy)phenyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | CCCc1n[nH]c(=S)n1CC(=O)Nc1cccc(OCC2CCCO2)c1 |
| InChI | InChI=1S/C18H24N4O3S/c1-2-5-16-20-21-18(26)22(16)11-17(23)19-13-6-3-7-14(10-13)25-12-15-8-4-9-24-15/h3,6-7,10,15H,2,4-5,8-9,11-12H2,1H3,(H,19,23)(H,21,26) |
| InChIKey | KOUQAYGYKWYBJD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|