C20H21N5OS — CID 43058456
4-amino-2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylpyrimidine-5-carbonitrile (PubChem CID 43058456) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is 4-amino-2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylpyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 43058456 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 4-amino-2-[(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butan-2-yl]sulfanylpyrimidine-5-carbonitrile |
| SMILES | CC(Sc1ncc(C#N)c(N)n1)C(=O)/C=C1/N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C20H21N5OS/c1-12(27-19-23-11-13(10-21)18(22)24-19)16(26)9-17-20(2,3)14-7-5-6-8-15(14)25(17)4/h5-9,11-12H,1-4H3,(H2,22,23,24)/b17-9+ |
| InChIKey | FABAEZFGLYYINH-RQZCQDPDSA-N |
| XLogP | 3.29 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|