C24H23NO6 — CID 43059713
(7-methoxynaphthalen-2-yl) 1-(2,5-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 43059713) has the molecular formula C24H23NO6 and a molecular weight of 421.45 g/mol. Its IUPAC name is (7-methoxynaphthalen-2-yl) 1-(2,5-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (7-methoxynaphthalen-2-yl) 1-(2,5-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 43059713 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (7-methoxynaphthalen-2-yl) 1-(2,5-dimethoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1ccc(OC)c(N2CC(C(=O)Oc3ccc4ccc(OC)cc4c3)CC2=O)c1 |
| InChI | InChI=1S/C24H23NO6/c1-28-18-6-4-15-5-7-20(11-16(15)10-18)31-24(27)17-12-23(26)25(14-17)21-13-19(29-2)8-9-22(21)30-3/h4-11,13,17H,12,14H2,1-3H3 |
| InChIKey | JQLGXBKTNNYQSA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|