C26H36N4O2 — CID 43061248
2-(4-benzylpiperazin-1-yl)-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]acetamide (PubChem CID 43061248) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]acetamide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]acetamide |
|---|---|
| PubChem CID | 43061248 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-N-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]acetamide |
| SMILES | COc1ccc(C(CNC(=O)CN2CCN(Cc3ccccc3)CC2)N2CCCC2)cc1 |
| InChI | InChI=1S/C26H36N4O2/c1-32-24-11-9-23(10-12-24)25(30-13-5-6-14-30)19-27-26(31)21-29-17-15-28(16-18-29)20-22-7-3-2-4-8-22/h2-4,7-12,25H,5-6,13-21H2,1H3,(H,27,31) |
| InChIKey | FGQWMDUSJZPOOI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |