C20H21NO4 — CID 43062738
2,3-dihydro-1,4-benzoxazin-4-yl-(3,4-dimethoxy-5-prop-2-enylphenyl)methanone (PubChem CID 43062738) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzoxazin-4-yl-(3,4-dimethoxy-5-prop-2-enylphenyl)methanone.
| Compound Name | 2,3-dihydro-1,4-benzoxazin-4-yl-(3,4-dimethoxy-5-prop-2-enylphenyl)methanone |
|---|---|
| PubChem CID | 43062738 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2,3-dihydro-1,4-benzoxazin-4-yl-(3,4-dimethoxy-5-prop-2-enylphenyl)methanone |
| SMILES | C=CCc1cc(C(=O)N2CCOc3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C20H21NO4/c1-4-7-14-12-15(13-18(23-2)19(14)24-3)20(22)21-10-11-25-17-9-6-5-8-16(17)21/h4-6,8-9,12-13H,1,7,10-11H2,2-3H3 |
| InChIKey | ABGAAAJWYBCSHV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|