About 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-3-(trifluoromethyl)piperidine
1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-3-(trifluoromethyl)piperidine (PubChem CID 43063319) has the molecular formula C15H16F3N5O2
and a molecular weight of 355.32 g/mol. Its IUPAC name is 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-3-(trifluoromethyl)piperidine.
Molecular Properties
| Compound Name | 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-3-(trifluoromethyl)piperidine |
| PubChem CID | 43063319 |
| Molecular Formula | C15H16F3N5O2 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-3-(trifluoromethyl)piperidine |
| SMILES | O=[N+]([O-])c1ccc(-c2ncn(CN3CCCC(C(F)(F)F)C3)n2)cc1 |
| InChI | InChI=1S/C15H16F3N5O2/c16-15(17,18)12-2-1-7-21(8-12)10-22-9-19-14(20-22)11-3-5-13(6-4-11)23(24)25/h3-6,9,12H,1-2,7-8,10H2 |
| InChIKey | JPKUAYKOPZCPEI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-3-(trifluoromethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-3-(trifluoromethyl)piperidine?
The IUPAC name of 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-3-(trifluoromethyl)piperidine (CID 43063319) is 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-3-(trifluoromethyl)piperidine.
What is the SMILES notation for 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-3-(trifluoromethyl)piperidine?
The canonical SMILES for 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-3-(trifluoromethyl)piperidine is O=[N+]([O-])c1ccc(-c2ncn(CN3CCCC(C(F)(F)F)C3)n2)cc1.
What is the InChIKey of 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-3-(trifluoromethyl)piperidine?
The InChIKey is JPKUAYKOPZCPEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F3N5O2/c16-15(17,18)12-2-1-7-21(8-12)10-22-9-19-14(20-22)11-3-5-13(6-4-11)23(24)25/h3-6,9,12H,1-2,7-8,10H2.
What are the key properties of 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-3-(trifluoromethyl)piperidine?
1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-3-(trifluoromethyl)piperidine has a molecular weight of 355.32 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3-(4-nitrophenyl)-1,2,4-triazol-1-yl]methyl]-3-(trifluoromethyl)piperidine is sourced from PubChem (CID 43063319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).