C21H19BrF3N3O — CID 43063574
4-(4-bromophenyl)-2-[[3-(trifluoromethyl)piperidin-1-yl]methyl]phthalazin-1-one (PubChem CID 43063574) has the molecular formula C21H19BrF3N3O and a molecular weight of 466.30 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-[[3-(trifluoromethyl)piperidin-1-yl]methyl]phthalazin-1-one.
| Compound Name | 4-(4-bromophenyl)-2-[[3-(trifluoromethyl)piperidin-1-yl]methyl]phthalazin-1-one |
|---|---|
| PubChem CID | 43063574 |
| Molecular Formula | C21H19BrF3N3O |
| Molecular Weight | 466.30 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 4-(4-bromophenyl)-2-[[3-(trifluoromethyl)piperidin-1-yl]methyl]phthalazin-1-one |
| SMILES | O=c1c2ccccc2c(-c2ccc(Br)cc2)nn1CN1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C21H19BrF3N3O/c22-16-9-7-14(8-10-16)19-17-5-1-2-6-18(17)20(29)28(26-19)13-27-11-3-4-15(12-27)21(23,24)25/h1-2,5-10,15H,3-4,11-13H2 |
| InChIKey | UBLBHHFXEBBPKD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.30 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |