C20H19N5O4 — CID 43063638
methyl 1-[4-(3-benzamidopropanoylamino)phenyl]triazole-4-carboxylate (PubChem CID 43063638) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is methyl 1-[4-(3-benzamidopropanoylamino)phenyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[4-(3-benzamidopropanoylamino)phenyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 43063638 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | methyl 1-[4-(3-benzamidopropanoylamino)phenyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(-c2ccc(NC(=O)CCNC(=O)c3ccccc3)cc2)nn1 |
| InChI | InChI=1S/C20H19N5O4/c1-29-20(28)17-13-25(24-23-17)16-9-7-15(8-10-16)22-18(26)11-12-21-19(27)14-5-3-2-4-6-14/h2-10,13H,11-12H2,1H3,(H,21,27)(H,22,26) |
| InChIKey | SHBKMCAZCJACGY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |