C20H21N3O4S — CID 43063654
3-[(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-5-phenyl-1,3,4-oxadiazole-2-thione (PubChem CID 43063654) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 3-[(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-5-phenyl-1,3,4-oxadiazole-2-thione.
| Compound Name | 3-[(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-5-phenyl-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 43063654 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3-[(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-5-phenyl-1,3,4-oxadiazole-2-thione |
| SMILES | COc1ccc(OC)c2c1CN(Cn1nc(-c3ccccc3)oc1=S)CC2O |
| InChI | InChI=1S/C20H21N3O4S/c1-25-16-8-9-17(26-2)18-14(16)10-22(11-15(18)24)12-23-20(28)27-19(21-23)13-6-4-3-5-7-13/h3-9,15,24H,10-12H2,1-2H3 |
| InChIKey | CYMRTPNRKFFBHZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 72.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|