About 3,5-diethyl-1H-pyrazole
3,5-diethyl-1H-pyrazole (PubChem CID 4306367) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 3,5-diethyl-1H-pyrazole.
Molecular Properties
| Compound Name | 3,5-diethyl-1H-pyrazole |
| PubChem CID | 4306367 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 3,5-diethyl-1H-pyrazole |
| SMILES | CCc1cc(CC)[nH]n1 |
| InChI | InChI=1S/C7H12N2/c1-3-6-5-7(4-2)9-8-6/h5H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | UFLLSVUGUWBXJA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-diethyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethyl-1H-pyrazole?
The IUPAC name of 3,5-diethyl-1H-pyrazole (CID 4306367) is 3,5-diethyl-1H-pyrazole.
What is the SMILES notation for 3,5-diethyl-1H-pyrazole?
The canonical SMILES for 3,5-diethyl-1H-pyrazole is CCc1cc(CC)[nH]n1.
What is the InChIKey of 3,5-diethyl-1H-pyrazole?
The InChIKey is UFLLSVUGUWBXJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-3-6-5-7(4-2)9-8-6/h5H,3-4H2,1-2H3,(H,8,9).
What are the key properties of 3,5-diethyl-1H-pyrazole?
3,5-diethyl-1H-pyrazole has a molecular weight of 124.19 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-1H-pyrazole is sourced from PubChem (CID 4306367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).