C26H32N4O2S2 — CID 4306519
N-[4-(diethylamino)phenyl]-2-[(7-methyl-4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 4306519) has the molecular formula C26H32N4O2S2 and a molecular weight of 496.70 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-2-[(7-methyl-4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-[4-(diethylamino)phenyl]-2-[(7-methyl-4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4306519 |
| Molecular Formula | C26H32N4O2S2 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-2-[(7-methyl-4-oxo-3-prop-2-enyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(N(CC)CC)cc2)nc2sc3c(c2c1=O)CCC(C)C3 |
| InChI | InChI=1S/C26H32N4O2S2/c1-5-14-30-25(32)23-20-13-8-17(4)15-21(20)34-24(23)28-26(30)33-16-22(31)27-18-9-11-19(12-10-18)29(6-2)7-3/h5,9-12,17H,1,6-8,13-16H2,2-4H3,(H,27,31) |
| InChIKey | RTANGOYYTXRNCC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|