About 3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-4-(4-methylphenyl)sulfanylbenzamide
3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-4-(4-methylphenyl)sulfanylbenzamide (PubChem CID 4306611) has the molecular formula C24H22N2O4S
and a molecular weight of 434.52 g/mol. Its IUPAC name is 3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-4-(4-methylphenyl)sulfanylbenzamide.
Molecular Properties
| Compound Name | 3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-4-(4-methylphenyl)sulfanylbenzamide |
| PubChem CID | 4306611 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-4-(4-methylphenyl)sulfanylbenzamide |
| SMILES | CC(=O)Nc1cc(C(=O)NCc2ccc3c(c2)OCO3)ccc1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C24H22N2O4S/c1-15-3-7-19(8-4-15)31-23-10-6-18(12-20(23)26-16(2)27)24(28)25-13-17-5-9-21-22(11-17)30-14-29-21/h3-12H,13-14H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | QDOJSFIOJBCBJM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-4-(4-methylphenyl)sulfanylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-4-(4-methylphenyl)sulfanylbenzamide?
The IUPAC name of 3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-4-(4-methylphenyl)sulfanylbenzamide (CID 4306611) is 3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-4-(4-methylphenyl)sulfanylbenzamide.
What is the SMILES notation for 3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-4-(4-methylphenyl)sulfanylbenzamide?
The canonical SMILES for 3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-4-(4-methylphenyl)sulfanylbenzamide is CC(=O)Nc1cc(C(=O)NCc2ccc3c(c2)OCO3)ccc1Sc1ccc(C)cc1.
What is the InChIKey of 3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-4-(4-methylphenyl)sulfanylbenzamide?
The InChIKey is QDOJSFIOJBCBJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O4S/c1-15-3-7-19(8-4-15)31-23-10-6-18(12-20(23)26-16(2)27)24(28)25-13-17-5-9-21-22(11-17)30-14-29-21/h3-12H,13-14H2,1-2H3,(H,25,28)(H,26,27).
What are the key properties of 3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-4-(4-methylphenyl)sulfanylbenzamide?
3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-4-(4-methylphenyl)sulfanylbenzamide has a molecular weight of 434.52 g/mol, XLogP of 4.76, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetamido-N-(1,3-benzodioxol-5-ylmethyl)-4-(4-methylphenyl)sulfanylbenzamide is sourced from PubChem (CID 4306611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).