C18H20N2O5 — CID 4306811
(2-oxo-2-piperidin-1-ylethyl) 2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 4306811) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) 2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) 2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 4306811 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) 2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC(C(=O)OCC(=O)N1CCCCC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H20N2O5/c1-12(18(24)25-11-15(21)19-9-5-2-6-10-19)20-16(22)13-7-3-4-8-14(13)17(20)23/h3-4,7-8,12H,2,5-6,9-11H2,1H3 |
| InChIKey | QDEZMCUDSJGPDC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|