C16H13BrF4N2O — CID 43068432
2-bromo-N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-4-fluorobenzamide (PubChem CID 43068432) has the molecular formula C16H13BrF4N2O and a molecular weight of 405.19 g/mol. Its IUPAC name is 2-bromo-N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-4-fluorobenzamide.
| Compound Name | 2-bromo-N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 43068432 |
| Molecular Formula | C16H13BrF4N2O |
| Molecular Weight | 405.19 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 2-bromo-N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-4-fluorobenzamide |
| SMILES | CN(C)c1ccc(NC(=O)c2ccc(F)cc2Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13BrF4N2O/c1-23(2)10-4-6-14(12(8-10)16(19,20)21)22-15(24)11-5-3-9(18)7-13(11)17/h3-8H,1-2H3,(H,22,24) |
| InChIKey | RADWILSHKPZVCN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.19 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |