C17H17F3N6OS2 — CID 43070496
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide (PubChem CID 43070496) has the molecular formula C17H17F3N6OS2 and a molecular weight of 442.49 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 43070496 |
| Molecular Formula | C17H17F3N6OS2 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5-propan-2-yl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxamide |
| SMILES | CCSc1nnc(NC(=O)c2cnn(-c3ccc(C(F)(F)F)cn3)c2C(C)C)s1 |
| InChI | InChI=1S/C17H17F3N6OS2/c1-4-28-16-25-24-15(29-16)23-14(27)11-8-22-26(13(11)9(2)3)12-6-5-10(7-21-12)17(18,19)20/h5-9H,4H2,1-3H3,(H,23,24,27) |
| InChIKey | GXZMBWFKOQMSKZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|