C19H18N2O2 — CID 43071444
(E)-1-(2-methoxy-4-methylphenyl)-3-(3-methylimidazo[1,5-a]pyridin-1-yl)prop-2-en-1-one (PubChem CID 43071444) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (E)-1-(2-methoxy-4-methylphenyl)-3-(3-methylimidazo[1,5-a]pyridin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(2-methoxy-4-methylphenyl)-3-(3-methylimidazo[1,5-a]pyridin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 43071444 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (E)-1-(2-methoxy-4-methylphenyl)-3-(3-methylimidazo[1,5-a]pyridin-1-yl)prop-2-en-1-one |
| SMILES | COc1cc(C)ccc1C(=O)/C=C/c1nc(C)n2ccccc12 |
| InChI | InChI=1S/C19H18N2O2/c1-13-7-8-15(19(12-13)23-3)18(22)10-9-16-17-6-4-5-11-21(17)14(2)20-16/h4-12H,1-3H3/b10-9+ |
| InChIKey | OEQJYPJPPLQJFP-MDZDMXLPSA-N |
| XLogP | 3.86 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|