C18H17ClN6O3S — CID 43072004
N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetamide (PubChem CID 43072004) has the molecular formula C18H17ClN6O3S and a molecular weight of 432.89 g/mol. Its IUPAC name is N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetamide.
| Compound Name | N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetamide |
|---|---|
| PubChem CID | 43072004 |
| Molecular Formula | C18H17ClN6O3S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | N-(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)-2-(5,7-dimethyl-2-methylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetamide |
| SMILES | CSc1nc2nc(C)c(CC(=O)Nc3cc4c(cc3Cl)NC(=O)CO4)c(C)n2n1 |
| InChI | InChI=1S/C18H17ClN6O3S/c1-8-10(9(2)25-17(20-8)23-18(24-25)29-3)4-15(26)21-12-6-14-13(5-11(12)19)22-16(27)7-28-14/h5-6H,4,7H2,1-3H3,(H,21,26)(H,22,27) |
| InChIKey | USRMCIFJNFNUTR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |