C19H19F3N4O4S — CID 43072116
N-[3-[[ethyl-(2,2,2-trifluoroacetyl)amino]methyl]phenyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide (PubChem CID 43072116) has the molecular formula C19H19F3N4O4S and a molecular weight of 456.45 g/mol. Its IUPAC name is N-[3-[[ethyl-(2,2,2-trifluoroacetyl)amino]methyl]phenyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide.
| Compound Name | N-[3-[[ethyl-(2,2,2-trifluoroacetyl)amino]methyl]phenyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 43072116 |
| Molecular Formula | C19H19F3N4O4S |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | N-[3-[[ethyl-(2,2,2-trifluoroacetyl)amino]methyl]phenyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
| SMILES | CCN(Cc1cccc(NC(=O)C2=CN3CCS(=O)(=O)N=C3C=C2)c1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C19H19F3N4O4S/c1-2-25(18(28)19(20,21)22)11-13-4-3-5-15(10-13)23-17(27)14-6-7-16-24-31(29,30)9-8-26(16)12-14/h3-7,10,12H,2,8-9,11H2,1H3,(H,23,27) |
| InChIKey | GEUDGHWOHMQFMM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |