C23H23ClN4O4 — CID 43072347
3-(3a-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazolin-4-yl)-N'-[2-(4-chlorophenyl)acetyl]propanehydrazide (PubChem CID 43072347) has the molecular formula C23H23ClN4O4 and a molecular weight of 454.91 g/mol. Its IUPAC name is 3-(3a-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazolin-4-yl)-N'-[2-(4-chlorophenyl)acetyl]propanehydrazide.
| Compound Name | 3-(3a-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazolin-4-yl)-N'-[2-(4-chlorophenyl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 43072347 |
| Molecular Formula | C23H23ClN4O4 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 3-(3a-methyl-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazolin-4-yl)-N'-[2-(4-chlorophenyl)acetyl]propanehydrazide |
| SMILES | CC12CCC(=O)N1c1ccccc1C(=O)N2CCC(=O)NNC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClN4O4/c1-23-12-10-21(31)28(23)18-5-3-2-4-17(18)22(32)27(23)13-11-19(29)25-26-20(30)14-15-6-8-16(24)9-7-15/h2-9H,10-14H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | KPKNQHKXEYMAEP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|