About N-[[1-(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)piperidin-2-yl]methyl]methanesulfonamide
N-[[1-(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)piperidin-2-yl]methyl]methanesulfonamide (PubChem CID 43073356) has the molecular formula C15H19N3O3S3
and a molecular weight of 385.54 g/mol. Its IUPAC name is N-[[1-(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)piperidin-2-yl]methyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[[1-(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)piperidin-2-yl]methyl]methanesulfonamide |
| PubChem CID | 43073356 |
| Molecular Formula | C15H19N3O3S3 |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | N-[[1-(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)piperidin-2-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC1CCCCN1C(=O)c1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C15H19N3O3S3/c1-24(20,21)16-8-12-4-2-3-6-18(12)15(19)13-10-23-14(17-13)11-5-7-22-9-11/h5,7,9-10,12,16H,2-4,6,8H2,1H3 |
| InChIKey | ZSTJUWLCERLXKX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[1-(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)piperidin-2-yl]methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)piperidin-2-yl]methyl]methanesulfonamide?
The IUPAC name of N-[[1-(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)piperidin-2-yl]methyl]methanesulfonamide (CID 43073356) is N-[[1-(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)piperidin-2-yl]methyl]methanesulfonamide.
What is the SMILES notation for N-[[1-(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)piperidin-2-yl]methyl]methanesulfonamide?
The canonical SMILES for N-[[1-(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)piperidin-2-yl]methyl]methanesulfonamide is CS(=O)(=O)NCC1CCCCN1C(=O)c1csc(-c2ccsc2)n1.
What is the InChIKey of N-[[1-(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)piperidin-2-yl]methyl]methanesulfonamide?
The InChIKey is ZSTJUWLCERLXKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O3S3/c1-24(20,21)16-8-12-4-2-3-6-18(12)15(19)13-10-23-14(17-13)11-5-7-22-9-11/h5,7,9-10,12,16H,2-4,6,8H2,1H3.
What are the key properties of N-[[1-(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)piperidin-2-yl]methyl]methanesulfonamide?
N-[[1-(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)piperidin-2-yl]methyl]methanesulfonamide has a molecular weight of 385.54 g/mol, XLogP of 2.42, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)piperidin-2-yl]methyl]methanesulfonamide is sourced from PubChem (CID 43073356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).