C24H28Cl2N4O2 — CID 4307358
2,6-dibutyl-1,5-bis(4-chlorophenyl)-1,5-dihydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dione (PubChem CID 4307358) has the molecular formula C24H28Cl2N4O2 and a molecular weight of 475.42 g/mol. Its IUPAC name is 2,6-dibutyl-1,5-bis(4-chlorophenyl)-1,5-dihydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dione.
| Compound Name | 2,6-dibutyl-1,5-bis(4-chlorophenyl)-1,5-dihydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dione |
|---|---|
| PubChem CID | 4307358 |
| Molecular Formula | C24H28Cl2N4O2 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 2,6-dibutyl-1,5-bis(4-chlorophenyl)-1,5-dihydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dione |
| SMILES | CCCCN1C(=O)N2C(c3ccc(Cl)cc3)N(CCCC)C(=O)N2C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H28Cl2N4O2/c1-3-5-15-27-21(17-7-11-19(25)12-8-17)29-24(32)28(16-6-4-2)22(30(29)23(27)31)18-9-13-20(26)14-10-18/h7-14,21-22H,3-6,15-16H2,1-2H3 |
| InChIKey | YLSIKPDHTGYSBR-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |