About methyl 2-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]propanoate
methyl 2-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]propanoate (PubChem CID 43074346) has the molecular formula C14H21N3O3
and a molecular weight of 279.34 g/mol. Its IUPAC name is methyl 2-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]propanoate.
Molecular Properties
| Compound Name | methyl 2-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]propanoate |
| PubChem CID | 43074346 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | methyl 2-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]propanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)/C=C/c1c(C)nn(C)c1C |
| InChI | InChI=1S/C14H21N3O3/c1-9-11(10(2)17(5)16-9)7-8-12(18)15-14(3,4)13(19)20-6/h7-8H,1-6H3,(H,15,18)/b8-7+ |
| InChIKey | JKEOVPVZYSPCJW-BQYQJAHWSA-N |
| XLogP | 1.12 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]propanoate?
The IUPAC name of methyl 2-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]propanoate (CID 43074346) is methyl 2-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]propanoate.
What is the SMILES notation for methyl 2-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]propanoate?
The canonical SMILES for methyl 2-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]propanoate is COC(=O)C(C)(C)NC(=O)/C=C/c1c(C)nn(C)c1C.
What is the InChIKey of methyl 2-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]propanoate?
The InChIKey is JKEOVPVZYSPCJW-BQYQJAHWSA-N. The full InChI is InChI=1S/C14H21N3O3/c1-9-11(10(2)17(5)16-9)7-8-12(18)15-14(3,4)13(19)20-6/h7-8H,1-6H3,(H,15,18)/b8-7+.
What are the key properties of methyl 2-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]propanoate?
methyl 2-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]propanoate has a molecular weight of 279.34 g/mol, XLogP of 1.12, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-2-[[(E)-3-(1,3,5-trimethylpyrazol-4-yl)prop-2-enoyl]amino]propanoate is sourced from PubChem (CID 43074346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).