C11H17N5O3S — CID 43074413
methyl 2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-2-methylpropanoate (PubChem CID 43074413) has the molecular formula C11H17N5O3S and a molecular weight of 299.36 g/mol. Its IUPAC name is methyl 2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 43074413 |
| Molecular Formula | C11H17N5O3S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | methyl 2-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)CSc1nnnn1C1CC1 |
| InChI | InChI=1S/C11H17N5O3S/c1-11(2,9(18)19-3)12-8(17)6-20-10-13-14-15-16(10)7-4-5-7/h7H,4-6H2,1-3H3,(H,12,17) |
| InChIKey | PGMJGSKMIQLHPW-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |