About 1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(4-phenoxyphenyl)thiourea
1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(4-phenoxyphenyl)thiourea (PubChem CID 43076285) has the molecular formula C24H21N3O3S
and a molecular weight of 431.52 g/mol. Its IUPAC name is 1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(4-phenoxyphenyl)thiourea.
Molecular Properties
| Compound Name | 1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(4-phenoxyphenyl)thiourea |
| PubChem CID | 43076285 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(4-phenoxyphenyl)thiourea |
| SMILES | O=C1CCCC(=O)N1c1ccc(NC(=S)Nc2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H21N3O3S/c28-22-7-4-8-23(29)27(22)19-13-9-17(10-14-19)25-24(31)26-18-11-15-21(16-12-18)30-20-5-2-1-3-6-20/h1-3,5-6,9-16H,4,7-8H2,(H2,25,26,31) |
| InChIKey | ASYOCLASGBFMBK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(4-phenoxyphenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(4-phenoxyphenyl)thiourea?
The IUPAC name of 1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(4-phenoxyphenyl)thiourea (CID 43076285) is 1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(4-phenoxyphenyl)thiourea.
What is the SMILES notation for 1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(4-phenoxyphenyl)thiourea?
The canonical SMILES for 1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(4-phenoxyphenyl)thiourea is O=C1CCCC(=O)N1c1ccc(NC(=S)Nc2ccc(Oc3ccccc3)cc2)cc1.
What is the InChIKey of 1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(4-phenoxyphenyl)thiourea?
The InChIKey is ASYOCLASGBFMBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N3O3S/c28-22-7-4-8-23(29)27(22)19-13-9-17(10-14-19)25-24(31)26-18-11-15-21(16-12-18)30-20-5-2-1-3-6-20/h1-3,5-6,9-16H,4,7-8H2,(H2,25,26,31).
What are the key properties of 1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(4-phenoxyphenyl)thiourea?
1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(4-phenoxyphenyl)thiourea has a molecular weight of 431.52 g/mol, XLogP of 5.33, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(4-phenoxyphenyl)thiourea is sourced from PubChem (CID 43076285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).