C16H27N3S — CID 43076925
1-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]-3-propylthiourea (PubChem CID 43076925) has the molecular formula C16H27N3S and a molecular weight of 293.48 g/mol. Its IUPAC name is 1-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]-3-propylthiourea.
| Compound Name | 1-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]-3-propylthiourea |
|---|---|
| PubChem CID | 43076925 |
| Molecular Formula | C16H27N3S |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 1-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]-3-propylthiourea |
| SMILES | CCCNC(=S)NCc1ccccc1CN(C)C(C)C |
| InChI | InChI=1S/C16H27N3S/c1-5-10-17-16(20)18-11-14-8-6-7-9-15(14)12-19(4)13(2)3/h6-9,13H,5,10-12H2,1-4H3,(H2,17,18,20) |
| InChIKey | GMROVGVMSZJPJK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|