About ethyl 4-[(2,4-dimethoxyphenyl)diazenyl]-1H-imidazole-5-carboxylate
ethyl 4-[(2,4-dimethoxyphenyl)diazenyl]-1H-imidazole-5-carboxylate (PubChem CID 4307729) has the molecular formula C14H16N4O4
and a molecular weight of 304.31 g/mol. Its IUPAC name is ethyl 4-[(2,4-dimethoxyphenyl)diazenyl]-1H-imidazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(2,4-dimethoxyphenyl)diazenyl]-1H-imidazole-5-carboxylate |
| PubChem CID | 4307729 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | ethyl 4-[(2,4-dimethoxyphenyl)diazenyl]-1H-imidazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]cnc1/N=N/c1ccc(OC)cc1OC |
| InChI | InChI=1S/C14H16N4O4/c1-4-22-14(19)12-13(16-8-15-12)18-17-10-6-5-9(20-2)7-11(10)21-3/h5-8H,4H2,1-3H3,(H,15,16)/b18-17+ |
| InChIKey | OUMBSDMBXRUAOY-ISLYRVAYSA-N |
| XLogP | 3.02 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(2,4-dimethoxyphenyl)diazenyl]-1H-imidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(2,4-dimethoxyphenyl)diazenyl]-1H-imidazole-5-carboxylate?
The IUPAC name of ethyl 4-[(2,4-dimethoxyphenyl)diazenyl]-1H-imidazole-5-carboxylate (CID 4307729) is ethyl 4-[(2,4-dimethoxyphenyl)diazenyl]-1H-imidazole-5-carboxylate.
What is the SMILES notation for ethyl 4-[(2,4-dimethoxyphenyl)diazenyl]-1H-imidazole-5-carboxylate?
The canonical SMILES for ethyl 4-[(2,4-dimethoxyphenyl)diazenyl]-1H-imidazole-5-carboxylate is CCOC(=O)c1[nH]cnc1/N=N/c1ccc(OC)cc1OC.
What is the InChIKey of ethyl 4-[(2,4-dimethoxyphenyl)diazenyl]-1H-imidazole-5-carboxylate?
The InChIKey is OUMBSDMBXRUAOY-ISLYRVAYSA-N. The full InChI is InChI=1S/C14H16N4O4/c1-4-22-14(19)12-13(16-8-15-12)18-17-10-6-5-9(20-2)7-11(10)21-3/h5-8H,4H2,1-3H3,(H,15,16)/b18-17+.
What are the key properties of ethyl 4-[(2,4-dimethoxyphenyl)diazenyl]-1H-imidazole-5-carboxylate?
ethyl 4-[(2,4-dimethoxyphenyl)diazenyl]-1H-imidazole-5-carboxylate has a molecular weight of 304.31 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(2,4-dimethoxyphenyl)diazenyl]-1H-imidazole-5-carboxylate is sourced from PubChem (CID 4307729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).