C18H26N2 — CID 43078792
N-[2-(1H-indol-3-yl)ethyl]-2,6-dimethylcyclohexan-1-amine (PubChem CID 43078792) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-2,6-dimethylcyclohexan-1-amine.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-2,6-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 43078792 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-2,6-dimethylcyclohexan-1-amine |
| SMILES | CC1CCCC(C)C1NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H26N2/c1-13-6-5-7-14(2)18(13)19-11-10-15-12-20-17-9-4-3-8-16(15)17/h3-4,8-9,12-14,18-20H,5-7,10-11H2,1-2H3 |
| InChIKey | INBKVZUEUOCCAY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |